C12H22N2O — CID 129255475
5-(4,4-dimethylpentyl)-3-propan-2-yl-1,2,4-oxadiazole (PubChem CID 129255475) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-(4,4-dimethylpentyl)-3-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(4,4-dimethylpentyl)-3-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 129255475 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 5-(4,4-dimethylpentyl)-3-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1noc(CCCC(C)(C)C)n1 |
| InChI | InChI=1S/C12H22N2O/c1-9(2)11-13-10(15-14-11)7-6-8-12(3,4)5/h9H,6-8H2,1-5H3 |
| InChIKey | CJHPYLMCTPGZDS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |