C16H19N5O2 — CID 133482477
5-phenyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-1,2,4-oxadiazol-3-amine (PubChem CID 133482477) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-phenyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-phenyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 133482477 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-phenyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-1,2,4-oxadiazol-3-amine |
| SMILES | CC(C)c1noc(CCCNc2noc(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C16H19N5O2/c1-11(2)14-18-13(22-20-14)9-6-10-17-16-19-15(23-21-16)12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3,(H,17,21) |
| InChIKey | GMQYLGNJDXCNNH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|