C14H19N3O2 — CID 133483445
4-methyl-5-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]pentan-2-ol (PubChem CID 133483445) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-methyl-5-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]pentan-2-ol.
| Compound Name | 4-methyl-5-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 133483445 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-methyl-5-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]pentan-2-ol |
| SMILES | CC(O)CC(C)CNc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H19N3O2/c1-10(8-11(2)18)9-15-14-16-13(19-17-14)12-6-4-3-5-7-12/h3-7,10-11,18H,8-9H2,1-2H3,(H,15,17) |
| InChIKey | USCHOCBXXMLDEP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |