C15H13N3O2 — CID 133482297
3-[[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]methyl]phenol (PubChem CID 133482297) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-[[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]methyl]phenol.
| Compound Name | 3-[[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 133482297 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-[[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]methyl]phenol |
| SMILES | Oc1cccc(CNc2noc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C15H13N3O2/c19-13-8-4-5-11(9-13)10-16-15-17-14(20-18-15)12-6-2-1-3-7-12/h1-9,19H,10H2,(H,16,18) |
| InChIKey | CUPMZZGUUKRVSE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |