C15H21N3O2 — CID 133483185
3-ethyl-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]pentan-2-ol (PubChem CID 133483185) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-ethyl-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]pentan-2-ol.
| Compound Name | 3-ethyl-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 133483185 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-ethyl-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]pentan-2-ol |
| SMILES | CCC(CC)C(O)CNc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H21N3O2/c1-3-11(4-2)13(19)10-16-15-17-14(20-18-15)12-8-6-5-7-9-12/h5-9,11,13,19H,3-4,10H2,1-2H3,(H,16,18) |
| InChIKey | OEALOZOGVWWLJU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |