C18H22N4O — CID 133305648
2-methyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]quinolin-4-amine (PubChem CID 133305648) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-methyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]quinolin-4-amine.
| Compound Name | 2-methyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 133305648 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-methyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]quinolin-4-amine |
| SMILES | Cc1cc(NCCCc2nc(C(C)C)no2)c2ccccc2n1 |
| InChI | InChI=1S/C18H22N4O/c1-12(2)18-21-17(23-22-18)9-6-10-19-16-11-13(3)20-15-8-5-4-7-14(15)16/h4-5,7-8,11-12H,6,9-10H2,1-3H3,(H,19,20) |
| InChIKey | DJVCUZZQMZUXSU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|