C35H25N4OP — CID 129257014
2-[4-(6-diphenylphosphoryl-3-pyridinyl)phenyl]-3-phenylimidazo[1,2-a]pyrimidine (PubChem CID 129257014) has the molecular formula C35H25N4OP and a molecular weight of 548.59 g/mol. Its IUPAC name is 2-[4-(6-diphenylphosphoryl-3-pyridinyl)phenyl]-3-phenylimidazo[1,2-a]pyrimidine.
| Compound Name | 2-[4-(6-diphenylphosphoryl-3-pyridinyl)phenyl]-3-phenylimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 129257014 |
| Molecular Formula | C35H25N4OP |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 2-[4-(6-diphenylphosphoryl-3-pyridinyl)phenyl]-3-phenylimidazo[1,2-a]pyrimidine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2ccc(-c3nc4ncccn4c3-c3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C35H25N4OP/c40-41(30-13-6-2-7-14-30,31-15-8-3-9-16-31)32-22-21-29(25-37-32)26-17-19-27(20-18-26)33-34(28-11-4-1-5-12-28)39-24-10-23-36-35(39)38-33/h1-25H |
| InChIKey | UNYQUQHRCQIDDX-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|