C9H8I2N2 — CID 129258654
N-[(Z)-2-(2,6-diiodo-4-methyl-3-pyridinyl)ethenyl]methanimine (PubChem CID 129258654) has the molecular formula C9H8I2N2 and a molecular weight of 397.99 g/mol. Its IUPAC name is N-[(Z)-2-(2,6-diiodo-4-methyl-3-pyridinyl)ethenyl]methanimine.
| Compound Name | N-[(Z)-2-(2,6-diiodo-4-methyl-3-pyridinyl)ethenyl]methanimine |
|---|---|
| PubChem CID | 129258654 |
| Molecular Formula | C9H8I2N2 |
| Molecular Weight | 397.99 g/mol |
| Exact Mass | 397.88 |
| IUPAC Name | N-[(Z)-2-(2,6-diiodo-4-methyl-3-pyridinyl)ethenyl]methanimine |
| SMILES | C=N/C=C\c1c(C)cc(I)nc1I |
| InChI | InChI=1S/C9H8I2N2/c1-6-5-8(10)13-9(11)7(6)3-4-12-2/h3-5H,2H2,1H3/b4-3- |
| InChIKey | QKNZTXRLNVDURX-ARJAWSKDSA-N |
| XLogP | 3.27 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.99 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|