C17H14BrNO3 — CID 1292594
3-(1,3-benzodioxol-5-ylamino)-1-(4-bromophenyl)but-2-en-1-one (PubChem CID 1292594) has the molecular formula C17H14BrNO3 and a molecular weight of 360.21 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-1-(4-bromophenyl)but-2-en-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-1-(4-bromophenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 1292594 |
| Molecular Formula | C17H14BrNO3 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-1-(4-bromophenyl)but-2-en-1-one |
| SMILES | CC(=CC(=O)c1ccc(Br)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14BrNO3/c1-11(8-15(20)12-2-4-13(18)5-3-12)19-14-6-7-16-17(9-14)22-10-21-16/h2-9,19H,10H2,1H3 |
| InChIKey | JVZAVILNYDAJAV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|