C21H27N5O5 — CID 129260624
7-[(6-oxo-2-pentyl-1H-pyrazin-3-yl)oxy]-1-pentyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione (PubChem CID 129260624) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is 7-[(6-oxo-2-pentyl-1H-pyrazin-3-yl)oxy]-1-pentyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione.
| Compound Name | 7-[(6-oxo-2-pentyl-1H-pyrazin-3-yl)oxy]-1-pentyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione |
|---|---|
| PubChem CID | 129260624 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 7-[(6-oxo-2-pentyl-1H-pyrazin-3-yl)oxy]-1-pentyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione |
| SMILES | CCCCCc1[nH]c(=O)cnc1Oc1cc(=O)c2c(=O)[nH]c(=O)n(CCCCC)c2[nH]1 |
| InChI | InChI=1S/C21H27N5O5/c1-3-5-7-9-13-20(22-12-15(28)23-13)31-16-11-14(27)17-18(24-16)26(10-8-6-4-2)21(30)25-19(17)29/h11-12H,3-10H2,1-2H3,(H,23,28)(H,24,27)(H,25,29,30) |
| InChIKey | LAQKTGGWXHORNX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|