C12H12FNO2 — CID 129262417
(3S,4R)-4-(5-fluoro-2-methylphenoxy)oxolane-3-carbonitrile (PubChem CID 129262417) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is (3S,4R)-4-(5-fluoro-2-methylphenoxy)oxolane-3-carbonitrile.
| Compound Name | (3S,4R)-4-(5-fluoro-2-methylphenoxy)oxolane-3-carbonitrile |
|---|---|
| PubChem CID | 129262417 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (3S,4R)-4-(5-fluoro-2-methylphenoxy)oxolane-3-carbonitrile |
| SMILES | Cc1ccc(F)cc1O[C@H]1COC[C@@H]1C#N |
| InChI | InChI=1S/C12H12FNO2/c1-8-2-3-10(13)4-11(8)16-12-7-15-6-9(12)5-14/h2-4,9,12H,6-7H2,1H3/t9-,12-/m0/s1 |
| InChIKey | VVXMYFSAVXGHEO-CABZTGNLSA-N |
| XLogP | 2.05 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |