C23H28N8O3 — CID 129272398
tert-butyl 1-amino-2-[2-(aminodiazenyl)-1,2-dihydropyridin-4-yl]-3-anilino-4-oxo-5,7-dihydropyrrolo[2,3-c]pyridine-6-carboxylate (PubChem CID 129272398) has the molecular formula C23H28N8O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is tert-butyl 1-amino-2-[2-(aminodiazenyl)-1,2-dihydropyridin-4-yl]-3-anilino-4-oxo-5,7-dihydropyrrolo[2,3-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl 1-amino-2-[2-(aminodiazenyl)-1,2-dihydropyridin-4-yl]-3-anilino-4-oxo-5,7-dihydropyrrolo[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 129272398 |
| Molecular Formula | C23H28N8O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | tert-butyl 1-amino-2-[2-(aminodiazenyl)-1,2-dihydropyridin-4-yl]-3-anilino-4-oxo-5,7-dihydropyrrolo[2,3-c]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)c2c(Nc3ccccc3)c(C3=CC(N=NN)NC=C3)n(N)c2C1 |
| InChI | InChI=1S/C23H28N8O3/c1-23(2,3)34-22(33)30-12-16-19(17(32)13-30)20(27-15-7-5-4-6-8-15)21(31(16)25)14-9-10-26-18(11-14)28-29-24/h4-11,18,26-27H,12-13,25H2,1-3H3,(H2,24,28) |
| InChIKey | LKWPIBNFGPHHDO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|