C11H24NO5P — CID 129273843
(3S,4R)-4-(3-diethoxyphosphorylpropoxy)pyrrolidin-3-ol (PubChem CID 129273843) has the molecular formula C11H24NO5P and a molecular weight of 281.29 g/mol. Its IUPAC name is (3S,4R)-4-(3-diethoxyphosphorylpropoxy)pyrrolidin-3-ol.
| Compound Name | (3S,4R)-4-(3-diethoxyphosphorylpropoxy)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129273843 |
| Molecular Formula | C11H24NO5P |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3S,4R)-4-(3-diethoxyphosphorylpropoxy)pyrrolidin-3-ol |
| SMILES | CCOP(=O)(CCCO[C@@H]1CNC[C@@H]1O)OCC |
| InChI | InChI=1S/C11H24NO5P/c1-3-16-18(14,17-4-2)7-5-6-15-11-9-12-8-10(11)13/h10-13H,3-9H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | SRZQDZZROPZXIX-WDEREUQCSA-N |
| XLogP | 0.99 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|