C8H18NO4P — CID 102516143
(3R,5S)-5-diethoxyphosphorylpyrrolidin-3-ol (PubChem CID 102516143) has the molecular formula C8H18NO4P and a molecular weight of 223.21 g/mol. Its IUPAC name is (3R,5S)-5-diethoxyphosphorylpyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-diethoxyphosphorylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 102516143 |
| Molecular Formula | C8H18NO4P |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (3R,5S)-5-diethoxyphosphorylpyrrolidin-3-ol |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C8H18NO4P/c1-3-12-14(11,13-4-2)8-5-7(10)6-9-8/h7-10H,3-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | YWRSUNVRWMFFDG-SFYZADRCSA-N |
| XLogP | 0.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|