C7H17ClNO5P — CID 11594118
(2S,3R,4R,5S)-2-dimethoxyphosphoryl-5-methylpyrrolidine-3,4-diol;hydrochloride (PubChem CID 11594118) has the molecular formula C7H17ClNO5P and a molecular weight of 261.64 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-dimethoxyphosphoryl-5-methylpyrrolidine-3,4-diol;hydrochloride.
| Compound Name | (2S,3R,4R,5S)-2-dimethoxyphosphoryl-5-methylpyrrolidine-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 11594118 |
| Molecular Formula | C7H17ClNO5P |
| Molecular Weight | 261.64 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | (2S,3R,4R,5S)-2-dimethoxyphosphoryl-5-methylpyrrolidine-3,4-diol;hydrochloride |
| SMILES | COP(=O)(OC)[C@@H]1N[C@@H](C)[C@@H](O)[C@H]1O.Cl |
| InChI | InChI=1S/C7H16NO5P.ClH/c1-4-5(9)6(10)7(8-4)14(11,12-2)13-3;/h4-10H,1-3H3;1H/t4-,5+,6+,7-;/m0./s1 |
| InChIKey | JGVKNMHSRYOCBK-MBWJBUSCSA-N |
| XLogP | -0.07 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.64 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|