C11H25ClNO6P — CID 11493701
(2R,3S,4R,5S)-2-(1-diethoxyphosphoryl-2-hydroxyethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride (PubChem CID 11493701) has the molecular formula C11H25ClNO6P and a molecular weight of 333.75 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(1-diethoxyphosphoryl-2-hydroxyethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride.
| Compound Name | (2R,3S,4R,5S)-2-(1-diethoxyphosphoryl-2-hydroxyethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 11493701 |
| Molecular Formula | C11H25ClNO6P |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (2R,3S,4R,5S)-2-(1-diethoxyphosphoryl-2-hydroxyethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride |
| SMILES | CCOP(=O)(OCC)C(CO)[C@@H]1N[C@@H](C)[C@@H](O)[C@H]1O.Cl |
| InChI | InChI=1S/C11H24NO6P.ClH/c1-4-17-19(16,18-5-2)8(6-13)9-11(15)10(14)7(3)12-9;/h7-15H,4-6H2,1-3H3;1H/t7-,8?,9-,10+,11-;/m0./s1 |
| InChIKey | JCNVZEASJXJMAW-GJAJUVPWSA-N |
| XLogP | 0.12 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|