C26H27FN4O3S — CID 129273855
3-[2-[2-[5-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-2-pyridinyl]ethylamino]ethyl]-1,3-thiazolidin-4-one (PubChem CID 129273855) has the molecular formula C26H27FN4O3S and a molecular weight of 494.59 g/mol. Its IUPAC name is 3-[2-[2-[5-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-2-pyridinyl]ethylamino]ethyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-[2-[5-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-2-pyridinyl]ethylamino]ethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 129273855 |
| Molecular Formula | C26H27FN4O3S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 3-[2-[2-[5-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-2-pyridinyl]ethylamino]ethyl]-1,3-thiazolidin-4-one |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3cc(F)ccc32)C=C1c1ccc(CCNCCN2CSCC2=O)nc1 |
| InChI | InChI=1S/C26H27FN4O3S/c1-26(2)20(12-22(34-26)24-19-6-4-17(27)11-21(19)30-25(24)33)16-3-5-18(29-13-16)7-8-28-9-10-31-15-35-14-23(31)32/h3-6,11-13,28H,7-10,14-15H2,1-2H3,(H,30,33)/b24-22+ |
| InChIKey | BBGPXDZVWYPYNT-ZNTNEXAZSA-N |
| XLogP | 3.44 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|