C30H11Cl3F10N2O4 — CID 129274373
2,3,9-trichloro-14-hydroxy-6,13-bis[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione (PubChem CID 129274373) has the molecular formula C30H11Cl3F10N2O4 and a molecular weight of 759.77 g/mol. Its IUPAC name is 2,3,9-trichloro-14-hydroxy-6,13-bis[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione.
| Compound Name | 2,3,9-trichloro-14-hydroxy-6,13-bis[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione |
|---|---|
| PubChem CID | 129274373 |
| Molecular Formula | C30H11Cl3F10N2O4 |
| Molecular Weight | 759.77 g/mol |
| Exact Mass | 757.96 |
| IUPAC Name | 2,3,9-trichloro-14-hydroxy-6,13-bis[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione |
| SMILES | O=C1c2c(Cl)cc3c4c(c(Cl)c(Cl)c(c24)C(=O)N1CCc1c(F)c(F)c(F)c(F)c1F)C(O)N(CCc1c(F)c(F)c(F)c(F)c1F)C3=O |
| InChI | InChI=1S/C30H11Cl3F10N2O4/c31-9-5-8-10-12-11(9)28(47)45(4-2-7-19(36)23(40)26(43)24(41)20(7)37)30(49)14(12)16(33)15(32)13(10)29(48)44(27(8)46)3-1-6-17(34)21(38)25(42)22(39)18(6)35/h5,29,48H,1-4H2 |
| InChIKey | ZZORBSAODDQLRY-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.77 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|