C18H23N5O4S — CID 129275063
tert-butyl 2-[(1S)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-7-yl]-4,5-dihydroimidazole-1-carboxylate (PubChem CID 129275063) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is tert-butyl 2-[(1S)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-7-yl]-4,5-dihydroimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-[(1S)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-7-yl]-4,5-dihydroimidazole-1-carboxylate |
|---|---|
| PubChem CID | 129275063 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | tert-butyl 2-[(1S)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-7-yl]-4,5-dihydroimidazole-1-carboxylate |
| SMILES | C=CCON1C(=O)N2C[C@H]1c1scnc1C2C1=NCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23N5O4S/c1-5-8-26-23-11-9-22(16(23)24)13(12-14(11)28-10-20-12)15-19-6-7-21(15)17(25)27-18(2,3)4/h5,10-11,13H,1,6-9H2,2-4H3/t11-,13?/m0/s1 |
| InChIKey | CLAOXSWYBXXUKO-AMGKYWFPSA-N |
| XLogP | 2.74 |
| TPSA | 87.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|