C18H23N7O5S — CID 129307338
tert-butyl N-(2-azidoethyl)-N-[(1S,7S)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carbonyl]carbamate (PubChem CID 129307338) has the molecular formula C18H23N7O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is tert-butyl N-(2-azidoethyl)-N-[(1S,7S)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carbonyl]carbamate.
| Compound Name | tert-butyl N-(2-azidoethyl)-N-[(1S,7S)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carbonyl]carbamate |
|---|---|
| PubChem CID | 129307338 |
| Molecular Formula | C18H23N7O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | tert-butyl N-(2-azidoethyl)-N-[(1S,7S)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carbonyl]carbamate |
| SMILES | C=CCON1C(=O)N2C[C@H]1c1scnc1[C@H]2C(=O)N(CCN=[N+]=[N-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23N7O5S/c1-5-8-29-25-11-9-24(16(25)27)13(12-14(11)31-10-20-12)15(26)23(7-6-21-22-19)17(28)30-18(2,3)4/h5,10-11,13H,1,6-9H2,2-4H3/t11-,13-/m0/s1 |
| InChIKey | NDXPOQODJPHTTE-AAEUAGOBSA-N |
| XLogP | 3.17 |
| TPSA | 141.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|