C10H11N3O2S — CID 129307342
(1S)-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-9-one (PubChem CID 129307342) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is (1S)-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-9-one.
| Compound Name | (1S)-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-9-one |
|---|---|
| PubChem CID | 129307342 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (1S)-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-9-one |
| SMILES | C=CCON1C(=O)N2Cc3ncsc3[C@@H]1C2 |
| InChI | InChI=1S/C10H11N3O2S/c1-2-3-15-13-8-5-12(10(13)14)4-7-9(8)16-6-11-7/h2,6,8H,1,3-5H2/t8-/m0/s1 |
| InChIKey | DXUIALAYFHMRIV-QMMMGPOBSA-N |
| XLogP | 1.55 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|