C25H27N5O2 — CID 129275421
N-[1-benzyl-2-(8-hydroxy-5-azatricyclo[4.3.0.01,4]nonan-5-yl)imidazo[4,5-b]pyridin-6-yl]-N-methylprop-2-enamide (PubChem CID 129275421) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[1-benzyl-2-(8-hydroxy-5-azatricyclo[4.3.0.01,4]nonan-5-yl)imidazo[4,5-b]pyridin-6-yl]-N-methylprop-2-enamide.
| Compound Name | N-[1-benzyl-2-(8-hydroxy-5-azatricyclo[4.3.0.01,4]nonan-5-yl)imidazo[4,5-b]pyridin-6-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 129275421 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[1-benzyl-2-(8-hydroxy-5-azatricyclo[4.3.0.01,4]nonan-5-yl)imidazo[4,5-b]pyridin-6-yl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1cnc2nc(N3C4CCC45CC(O)CC35)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C25H27N5O2/c1-3-22(32)28(2)17-11-19-23(26-14-17)27-24(29(19)15-16-7-5-4-6-8-16)30-20-9-10-25(20)13-18(31)12-21(25)30/h3-8,11,14,18,20-21,31H,1,9-10,12-13,15H2,2H3 |
| InChIKey | RWYRTWDLUMVASO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|