C25H34N6O — CID 145332848
N-[1-benzyl-2-[(1-methylpiperidin-4-yl)amino]imidazo[4,5-b]pyridin-6-yl]-N-methylprop-2-enamide;ethane (PubChem CID 145332848) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[1-benzyl-2-[(1-methylpiperidin-4-yl)amino]imidazo[4,5-b]pyridin-6-yl]-N-methylprop-2-enamide;ethane.
| Compound Name | N-[1-benzyl-2-[(1-methylpiperidin-4-yl)amino]imidazo[4,5-b]pyridin-6-yl]-N-methylprop-2-enamide;ethane |
|---|---|
| PubChem CID | 145332848 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | N-[1-benzyl-2-[(1-methylpiperidin-4-yl)amino]imidazo[4,5-b]pyridin-6-yl]-N-methylprop-2-enamide;ethane |
| SMILES | C=CC(=O)N(C)c1cnc2nc(NC3CCN(C)CC3)n(Cc3ccccc3)c2c1.CC |
| InChI | InChI=1S/C23H28N6O.C2H6/c1-4-21(30)28(3)19-14-20-22(24-15-19)26-23(25-18-10-12-27(2)13-11-18)29(20)16-17-8-6-5-7-9-17;1-2/h4-9,14-15,18H,1,10-13,16H2,2-3H3,(H,24,25,26);1-2H3 |
| InChIKey | OMDCBDRTGLBGJA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|