C18H21FN6O — CID 135588854
7-[(4-fluorophenyl)methyl]-8-[(1-methylpiperidin-4-yl)amino]-1H-purin-6-one (PubChem CID 135588854) has the molecular formula C18H21FN6O and a molecular weight of 356.41 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-8-[(1-methylpiperidin-4-yl)amino]-1H-purin-6-one.
| Compound Name | 7-[(4-fluorophenyl)methyl]-8-[(1-methylpiperidin-4-yl)amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 135588854 |
| Molecular Formula | C18H21FN6O |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-8-[(1-methylpiperidin-4-yl)amino]-1H-purin-6-one |
| SMILES | CN1CCC(Nc2nc3nc[nH]c(=O)c3n2Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H21FN6O/c1-24-8-6-14(7-9-24)22-18-23-16-15(17(26)21-11-20-16)25(18)10-12-2-4-13(19)5-3-12/h2-5,11,14H,6-10H2,1H3,(H2,20,21,22,23,26) |
| InChIKey | BIECQWSUGFDYPL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |