C21H26F2N6O — CID 129276844
2-(azetidin-1-yl)-N-[5,5-difluoro-1-[8-(methyliminomethyl)quinoxalin-5-yl]piperidin-3-yl]propanamide (PubChem CID 129276844) has the molecular formula C21H26F2N6O and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-(azetidin-1-yl)-N-[5,5-difluoro-1-[8-(methyliminomethyl)quinoxalin-5-yl]piperidin-3-yl]propanamide.
| Compound Name | 2-(azetidin-1-yl)-N-[5,5-difluoro-1-[8-(methyliminomethyl)quinoxalin-5-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 129276844 |
| Molecular Formula | C21H26F2N6O |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-(azetidin-1-yl)-N-[5,5-difluoro-1-[8-(methyliminomethyl)quinoxalin-5-yl]piperidin-3-yl]propanamide |
| SMILES | C/N=C/c1ccc(N2CC(NC(=O)C(C)N3CCC3)CC(F)(F)C2)c2nccnc12 |
| InChI | InChI=1S/C21H26F2N6O/c1-14(28-8-3-9-28)20(30)27-16-10-21(22,23)13-29(12-16)17-5-4-15(11-24-2)18-19(17)26-7-6-25-18/h4-7,11,14,16H,3,8-10,12-13H2,1-2H3,(H,27,30)/b24-11+ |
| InChIKey | WUEFKHBHCBVMHL-BHGWPJFGSA-N |
| XLogP | 2.10 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|