C23H32N6O — CID 146229440
5-methyl-1-[8-(methyliminomethyl)quinoxalin-5-yl]-N-(1-methylpiperidin-3-yl)piperidine-3-carboxamide (PubChem CID 146229440) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 5-methyl-1-[8-(methyliminomethyl)quinoxalin-5-yl]-N-(1-methylpiperidin-3-yl)piperidine-3-carboxamide.
| Compound Name | 5-methyl-1-[8-(methyliminomethyl)quinoxalin-5-yl]-N-(1-methylpiperidin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 146229440 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 5-methyl-1-[8-(methyliminomethyl)quinoxalin-5-yl]-N-(1-methylpiperidin-3-yl)piperidine-3-carboxamide |
| SMILES | C/N=C/c1ccc(N2CC(C)CC(C(=O)NC3CCCN(C)C3)C2)c2nccnc12 |
| InChI | InChI=1S/C23H32N6O/c1-16-11-18(23(30)27-19-5-4-10-28(3)15-19)14-29(13-16)20-7-6-17(12-24-2)21-22(20)26-9-8-25-21/h6-9,12,16,18-19H,4-5,10-11,13-15H2,1-3H3,(H,27,30)/b24-12+ |
| InChIKey | PGLSQGJSHJKBSR-WYMPLXKRSA-N |
| XLogP | 2.35 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|