C25H35N5O — CID 155461968
2-[(3R,5R)-3-methyl-5-[8-(methyliminomethyl)quinolin-5-yl]piperidin-1-yl]-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 155461968) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[(3R,5R)-3-methyl-5-[8-(methyliminomethyl)quinolin-5-yl]piperidin-1-yl]-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-[(3R,5R)-3-methyl-5-[8-(methyliminomethyl)quinolin-5-yl]piperidin-1-yl]-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 155461968 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 2-[(3R,5R)-3-methyl-5-[8-(methyliminomethyl)quinolin-5-yl]piperidin-1-yl]-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | C/N=C/c1ccc([C@H]2C[C@@H](C)CN(CC(=O)NC3CCN(C)CC3)C2)c2cccnc12 |
| InChI | InChI=1S/C25H35N5O/c1-18-13-20(22-7-6-19(14-26-2)25-23(22)5-4-10-27-25)16-30(15-18)17-24(31)28-21-8-11-29(3)12-9-21/h4-7,10,14,18,20-21H,8-9,11-13,15-17H2,1-3H3,(H,28,31)/b26-14+/t18-,20+/m1/s1 |
| InChIKey | LYIJNEUPSSPCQC-GHHHACQDSA-N |
| XLogP | 2.92 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|