C24H33N3O — CID 134249276
2-[(3S,5S)-3-methyl-5-(8-methylquinolin-5-yl)piperidin-1-yl]-2-(1-methylpiperidin-4-yl)acetaldehyde (PubChem CID 134249276) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-[(3S,5S)-3-methyl-5-(8-methylquinolin-5-yl)piperidin-1-yl]-2-(1-methylpiperidin-4-yl)acetaldehyde.
| Compound Name | 2-[(3S,5S)-3-methyl-5-(8-methylquinolin-5-yl)piperidin-1-yl]-2-(1-methylpiperidin-4-yl)acetaldehyde |
|---|---|
| PubChem CID | 134249276 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 2-[(3S,5S)-3-methyl-5-(8-methylquinolin-5-yl)piperidin-1-yl]-2-(1-methylpiperidin-4-yl)acetaldehyde |
| SMILES | Cc1ccc([C@@H]2C[C@H](C)CN(C(C=O)C3CCN(C)CC3)C2)c2cccnc12 |
| InChI | InChI=1S/C24H33N3O/c1-17-13-20(21-7-6-18(2)24-22(21)5-4-10-25-24)15-27(14-17)23(16-28)19-8-11-26(3)12-9-19/h4-7,10,16-17,19-20,23H,8-9,11-15H2,1-3H3/t17-,20+,23?/m0/s1 |
| InChIKey | MJNJYTOTICBWON-IVCMITIISA-N |
| XLogP | 3.88 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|