C18H22N4O — CID 155462055
(3R,5R)-3-methyl-5-[8-(methyliminomethyl)quinolin-5-yl]piperidine-1-carboxamide (PubChem CID 155462055) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is (3R,5R)-3-methyl-5-[8-(methyliminomethyl)quinolin-5-yl]piperidine-1-carboxamide.
| Compound Name | (3R,5R)-3-methyl-5-[8-(methyliminomethyl)quinolin-5-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 155462055 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (3R,5R)-3-methyl-5-[8-(methyliminomethyl)quinolin-5-yl]piperidine-1-carboxamide |
| SMILES | C/N=C/c1ccc([C@H]2C[C@@H](C)CN(C(N)=O)C2)c2cccnc12 |
| InChI | InChI=1S/C18H22N4O/c1-12-8-14(11-22(10-12)18(19)23)15-6-5-13(9-20-2)17-16(15)4-3-7-21-17/h3-7,9,12,14H,8,10-11H2,1-2H3,(H2,19,23)/b20-9+/t12-,14+/m1/s1 |
| InChIKey | WYBMEXLNZXHEDW-GAZDNGNESA-N |
| XLogP | 2.79 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|