C34H44Cl2N8O2 — CID 129281030
3-[4-[2-[4-[4-[(Z)-1-amino-2-[amino-[2-[3-chloro-4-[3-(methylamino)propoxy]phenyl]ethyl]amino]ethenyl]phenyl]triazol-1-yl]ethyl]-2-chlorophenoxy]-N-methylpropan-1-amine (PubChem CID 129281030) has the molecular formula C34H44Cl2N8O2 and a molecular weight of 667.69 g/mol. Its IUPAC name is 3-[4-[2-[4-[4-[(Z)-1-amino-2-[amino-[2-[3-chloro-4-[3-(methylamino)propoxy]phenyl]ethyl]amino]ethenyl]phenyl]triazol-1-yl]ethyl]-2-chlorophenoxy]-N-methylpropan-1-amine.
| Compound Name | 3-[4-[2-[4-[4-[(Z)-1-amino-2-[amino-[2-[3-chloro-4-[3-(methylamino)propoxy]phenyl]ethyl]amino]ethenyl]phenyl]triazol-1-yl]ethyl]-2-chlorophenoxy]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 129281030 |
| Molecular Formula | C34H44Cl2N8O2 |
| Molecular Weight | 667.69 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | 3-[4-[2-[4-[4-[(Z)-1-amino-2-[amino-[2-[3-chloro-4-[3-(methylamino)propoxy]phenyl]ethyl]amino]ethenyl]phenyl]triazol-1-yl]ethyl]-2-chlorophenoxy]-N-methylpropan-1-amine |
| SMILES | CNCCCOc1ccc(CCN(N)/C=C(\N)c2ccc(-c3cn(CCc4ccc(OCCCNC)c(Cl)c4)nn3)cc2)cc1Cl |
| InChI | InChI=1S/C34H44Cl2N8O2/c1-39-15-3-19-45-33-11-5-25(21-29(33)35)13-17-43(38)23-31(37)27-7-9-28(10-8-27)32-24-44(42-41-32)18-14-26-6-12-34(30(36)22-26)46-20-4-16-40-2/h5-12,21-24,39-40H,3-4,13-20,37-38H2,1-2H3/b31-23- |
| InChIKey | ARUIZGWQEZDSHV-SXBRIOAWSA-N |
| XLogP | 5.15 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|