C12H14F2O — CID 129283650
(1R,5S)-3-[(3,3-difluorocyclobutyl)methyl]bicyclo[3.2.0]hept-3-en-6-one (PubChem CID 129283650) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is (1R,5S)-3-[(3,3-difluorocyclobutyl)methyl]bicyclo[3.2.0]hept-3-en-6-one.
| Compound Name | (1R,5S)-3-[(3,3-difluorocyclobutyl)methyl]bicyclo[3.2.0]hept-3-en-6-one |
|---|---|
| PubChem CID | 129283650 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (1R,5S)-3-[(3,3-difluorocyclobutyl)methyl]bicyclo[3.2.0]hept-3-en-6-one |
| SMILES | O=C1C[C@H]2CC(CC3CC(F)(F)C3)=C[C@@H]12 |
| InChI | InChI=1S/C12H14F2O/c13-12(14)5-8(6-12)1-7-2-9-4-11(15)10(9)3-7/h3,8-10H,1-2,4-6H2/t9-,10-/m1/s1 |
| InChIKey | JSDVNBXWNPGROT-NXEZZACHSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|