C7H8O — CID 10986171
(1R,5S)-bicyclo[3.2.0]hept-3-en-6-one (PubChem CID 10986171) has the molecular formula C7H8O and a molecular weight of 108.14 g/mol. Its IUPAC name is (1R,5S)-bicyclo[3.2.0]hept-3-en-6-one.
| Compound Name | (1R,5S)-bicyclo[3.2.0]hept-3-en-6-one |
|---|---|
| PubChem CID | 10986171 |
| Molecular Formula | C7H8O |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | (1R,5S)-bicyclo[3.2.0]hept-3-en-6-one |
| SMILES | O=C1C[C@H]2CC=C[C@@H]12 |
| InChI | InChI=1S/C7H8O/c8-7-4-5-2-1-3-6(5)7/h1,3,5-6H,2,4H2/t5-,6-/m1/s1 |
| InChIKey | XBOYRBXLERDCAM-PHDIDXHHSA-N |
| XLogP | 1.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|