C12H14O — CID 130037715
tricyclo[6.2.2.02,7]dodeca-4,11-dien-9-one (PubChem CID 130037715) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is tricyclo[6.2.2.02,7]dodeca-4,11-dien-9-one.
| Compound Name | tricyclo[6.2.2.02,7]dodeca-4,11-dien-9-one |
|---|---|
| PubChem CID | 130037715 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | tricyclo[6.2.2.02,7]dodeca-4,11-dien-9-one |
| SMILES | O=C1CC2C=CC1C1CC=CCC21 |
| InChI | InChI=1S/C12H14O/c13-12-7-8-5-6-11(12)10-4-2-1-3-9(8)10/h1-2,5-6,8-11H,3-4,7H2 |
| InChIKey | LRMSMUZCUFFPPU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|