C17H20F3N3O4 — CID 129283978
[2-methyl-5-nitro-6-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3H-1-benzofuran-2-yl]methanol (PubChem CID 129283978) has the molecular formula C17H20F3N3O4 and a molecular weight of 387.36 g/mol. Its IUPAC name is [2-methyl-5-nitro-6-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3H-1-benzofuran-2-yl]methanol.
| Compound Name | [2-methyl-5-nitro-6-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3H-1-benzofuran-2-yl]methanol |
|---|---|
| PubChem CID | 129283978 |
| Molecular Formula | C17H20F3N3O4 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | [2-methyl-5-nitro-6-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3H-1-benzofuran-2-yl]methanol |
| SMILES | CC1(CO)Cc2cc([N+](=O)[O-])c(N3C[C@@H]4C[C@H]3CN4CC(F)(F)F)cc2O1 |
| InChI | InChI=1S/C17H20F3N3O4/c1-16(9-24)5-10-2-14(23(25)26)13(4-15(10)27-16)22-7-11-3-12(22)6-21(11)8-17(18,19)20/h2,4,11-12,24H,3,5-9H2,1H3/t11-,12-,16?/m0/s1 |
| InChIKey | WVMDXGXDYPXMJS-YSWZKLOHSA-N |
| XLogP | 2.11 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|