C14H18N2O4 — CID 129284143
(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine (PubChem CID 129284143) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine.
| Compound Name | (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine |
|---|---|
| PubChem CID | 129284143 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine |
| SMILES | CC1(C)Cc2cc([N+](=O)[O-])c(O[C@@H]3CCNC3)cc2O1 |
| InChI | InChI=1S/C14H18N2O4/c1-14(2)7-9-5-11(16(17)18)13(6-12(9)20-14)19-10-3-4-15-8-10/h5-6,10,15H,3-4,7-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | ZKMXCGHOQWQRHF-SNVBAGLBSA-N |
| XLogP | 2.05 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|