C12H15N3O4 — CID 129284369
7-morpholin-4-yl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 129284369) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 7-morpholin-4-yl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 7-morpholin-4-yl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 129284369 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 7-morpholin-4-yl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | O=[N+]([O-])c1cc2c(cc1N1CCOCC1)OCCN2 |
| InChI | InChI=1S/C12H15N3O4/c16-15(17)11-7-9-12(19-4-1-13-9)8-10(11)14-2-5-18-6-3-14/h7-8,13H,1-6H2 |
| InChIKey | ARVAVIKGENWRJR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|