C15H17NO6S — CID 129286728
7-amino-4-methyl-3-(3-methyl-2-oxobutyl)-2-oxochromene-6-sulfonic acid (PubChem CID 129286728) has the molecular formula C15H17NO6S and a molecular weight of 339.37 g/mol. Its IUPAC name is 7-amino-4-methyl-3-(3-methyl-2-oxobutyl)-2-oxochromene-6-sulfonic acid.
| Compound Name | 7-amino-4-methyl-3-(3-methyl-2-oxobutyl)-2-oxochromene-6-sulfonic acid |
|---|---|
| PubChem CID | 129286728 |
| Molecular Formula | C15H17NO6S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 7-amino-4-methyl-3-(3-methyl-2-oxobutyl)-2-oxochromene-6-sulfonic acid |
| SMILES | Cc1c(CC(=O)C(C)C)c(=O)oc2cc(N)c(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C15H17NO6S/c1-7(2)12(17)4-10-8(3)9-5-14(23(19,20)21)11(16)6-13(9)22-15(10)18/h5-7H,4,16H2,1-3H3,(H,19,20,21) |
| InChIKey | MHTJQLNCLPXIQW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|