C22H27NO7S — CID 122423687
[3-(2-ethoxy-2-oxoethyl)-9-ethyl-4,8,8-trimethyl-2-oxopyrano[3,2-g]quinolin-6-yl]methanesulfonic acid (PubChem CID 122423687) has the molecular formula C22H27NO7S and a molecular weight of 449.53 g/mol. Its IUPAC name is [3-(2-ethoxy-2-oxoethyl)-9-ethyl-4,8,8-trimethyl-2-oxopyrano[3,2-g]quinolin-6-yl]methanesulfonic acid.
| Compound Name | [3-(2-ethoxy-2-oxoethyl)-9-ethyl-4,8,8-trimethyl-2-oxopyrano[3,2-g]quinolin-6-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 122423687 |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [3-(2-ethoxy-2-oxoethyl)-9-ethyl-4,8,8-trimethyl-2-oxopyrano[3,2-g]quinolin-6-yl]methanesulfonic acid |
| SMILES | CCOC(=O)Cc1c(C)c2cc3c(cc2oc1=O)N(CC)C(C)(C)C=C3CS(=O)(=O)O |
| InChI | InChI=1S/C22H27NO7S/c1-6-23-18-10-19-15(13(3)16(21(25)30-19)9-20(24)29-7-2)8-17(18)14(11-22(23,4)5)12-31(26,27)28/h8,10-11H,6-7,9,12H2,1-5H3,(H,26,27,28) |
| InChIKey | BKRGCYSDHXSIII-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|