C34H49N4O5P — CID 122430100
3-[[di(propan-2-yl)amino]-[1-[2-(9-ethyl-4,6,8,8-tetramethyl-2-oxopyrano[3,2-g]quinolin-3-yl)acetyl]piperidin-4-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 122430100) has the molecular formula C34H49N4O5P and a molecular weight of 624.76 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[1-[2-(9-ethyl-4,6,8,8-tetramethyl-2-oxopyrano[3,2-g]quinolin-3-yl)acetyl]piperidin-4-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[1-[2-(9-ethyl-4,6,8,8-tetramethyl-2-oxopyrano[3,2-g]quinolin-3-yl)acetyl]piperidin-4-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 122430100 |
| Molecular Formula | C34H49N4O5P |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[1-[2-(9-ethyl-4,6,8,8-tetramethyl-2-oxopyrano[3,2-g]quinolin-3-yl)acetyl]piperidin-4-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | CCN1c2cc3oc(=O)c(CC(=O)N4CCC(OP(OCCC#N)N(C(C)C)C(C)C)CC4)c(C)c3cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C34H49N4O5P/c1-10-37-30-20-31-28(18-27(30)24(6)21-34(37,8)9)25(7)29(33(40)42-31)19-32(39)36-15-12-26(13-16-36)43-44(41-17-11-14-35)38(22(2)3)23(4)5/h18,20-23,26H,10-13,15-17,19H2,1-9H3 |
| InChIKey | IRSQDACQZAMEMB-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 99.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|