C38H47N4O5P — CID 118347501
3-[[di(propan-2-yl)amino]-[1-[2-[3-(ethylamino)-2,7-dimethyl-6-oxoxanthen-9-yl]benzoyl]piperidin-4-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 118347501) has the molecular formula C38H47N4O5P and a molecular weight of 670.79 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[1-[2-[3-(ethylamino)-2,7-dimethyl-6-oxoxanthen-9-yl]benzoyl]piperidin-4-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[1-[2-[3-(ethylamino)-2,7-dimethyl-6-oxoxanthen-9-yl]benzoyl]piperidin-4-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 118347501 |
| Molecular Formula | C38H47N4O5P |
| Molecular Weight | 670.79 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[1-[2-[3-(ethylamino)-2,7-dimethyl-6-oxoxanthen-9-yl]benzoyl]piperidin-4-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | CCNc1cc2oc3cc(=O)c(C)cc-3c(-c3ccccc3C(=O)N3CCC(OP(OCCC#N)N(C(C)C)C(C)C)CC3)c2cc1C |
| InChI | InChI=1S/C38H47N4O5P/c1-8-40-33-22-35-31(20-26(33)6)37(32-21-27(7)34(43)23-36(32)46-35)29-12-9-10-13-30(29)38(44)41-17-14-28(15-18-41)47-48(45-19-11-16-39)42(24(2)3)25(4)5/h9-10,12-13,20-25,28,40H,8,11,14-15,17-19H2,1-7H3 |
| InChIKey | WQKIYJSDISRMPO-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.79 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|