C19H28NNaO6S — CID 173039296
sodium;[1-(4-ethoxy-4-oxobutyl)-7-methoxy-2,2-dimethylquinolin-4-yl]methanesulfonic acid;hydride (PubChem CID 173039296) has the molecular formula C19H28NNaO6S and a molecular weight of 421.49 g/mol. Its IUPAC name is sodium;[1-(4-ethoxy-4-oxobutyl)-7-methoxy-2,2-dimethylquinolin-4-yl]methanesulfonic acid;hydride.
| Compound Name | sodium;[1-(4-ethoxy-4-oxobutyl)-7-methoxy-2,2-dimethylquinolin-4-yl]methanesulfonic acid;hydride |
|---|---|
| PubChem CID | 173039296 |
| Molecular Formula | C19H28NNaO6S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | sodium;[1-(4-ethoxy-4-oxobutyl)-7-methoxy-2,2-dimethylquinolin-4-yl]methanesulfonic acid;hydride |
| SMILES | CCOC(=O)CCCN1c2cc(OC)ccc2C(CS(=O)(=O)O)=CC1(C)C.[H-].[Na+] |
| InChI | InChI=1S/C19H27NO6S.Na.H/c1-5-26-18(21)7-6-10-20-17-11-15(25-4)8-9-16(17)14(12-19(20,2)3)13-27(22,23)24;;/h8-9,11-12H,5-7,10,13H2,1-4H3,(H,22,23,24);;/q;+1;-1 |
| InChIKey | OFXZWONHDSGKOU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|