ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate

C20H29NO4 — CID 122595730

IUPACethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate
SMILESCCOC(=O)CCCN1c2cc(OC)cc(OC)c2C(C)=CC1(C)C
InChIInChI=1S/C20H29NO4/c1-7-25-18(22)9-8-10-21-16-11-15(23-5)12-17(24-6)19(16)14(2)13-20(21,3)4/h11-13H,7-10H2,1-6H3
InChIKeyQBWGVOXZHBKVSY-UHFFFAOYSA-N
MW347.46 g/mol
LogP4.05
Rot. Bonds7

About ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate

ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate (PubChem CID 122595730) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate.

Molecular Properties

Compound Nameethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate
PubChem CID122595730
Molecular FormulaC20H29NO4
Molecular Weight347.46 g/mol
Exact Mass347.21
IUPAC Nameethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate
SMILESCCOC(=O)CCCN1c2cc(OC)cc(OC)c2C(C)=CC1(C)C
InChIInChI=1S/C20H29NO4/c1-7-25-18(22)9-8-10-21-16-11-15(23-5)12-17(24-6)19(16)14(2)13-20(21,3)4/h11-13H,7-10H2,1-6H3
InChIKeyQBWGVOXZHBKVSY-UHFFFAOYSA-N
XLogP4.05
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500347.46
LogP ≤ 54.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate?
The IUPAC name of ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate (CID 122595730) is ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate.
What is the SMILES notation for ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate?
The canonical SMILES for ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate is CCOC(=O)CCCN1c2cc(OC)cc(OC)c2C(C)=CC1(C)C.
What is the InChIKey of ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate?
The InChIKey is QBWGVOXZHBKVSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO4/c1-7-25-18(22)9-8-10-21-16-11-15(23-5)12-17(24-6)19(16)14(2)13-20(21,3)4/h11-13H,7-10H2,1-6H3.
What are the key properties of ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate?
ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate has a molecular weight of 347.46 g/mol, XLogP of 4.05, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate is sourced from PubChem (CID 122595730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).