C20H29NO4 — CID 122595730
ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate (PubChem CID 122595730) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate.
| Compound Name | ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate |
|---|---|
| PubChem CID | 122595730 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | ethyl 4-(5,7-dimethoxy-2,2,4-trimethylquinolin-1-yl)butanoate |
| SMILES | CCOC(=O)CCCN1c2cc(OC)cc(OC)c2C(C)=CC1(C)C |
| InChI | InChI=1S/C20H29NO4/c1-7-25-18(22)9-8-10-21-16-11-15(23-5)12-17(24-6)19(16)14(2)13-20(21,3)4/h11-13H,7-10H2,1-6H3 |
| InChIKey | QBWGVOXZHBKVSY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |