C29H35NO5 — CID 90685528
ethyl 4-[(10-methoxy-2,2,4-trimethyl-1-prop-2-enyl-5H-chromeno[3,4-f]quinolin-9-yl)oxy]butanoate (PubChem CID 90685528) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is ethyl 4-[(10-methoxy-2,2,4-trimethyl-1-prop-2-enyl-5H-chromeno[3,4-f]quinolin-9-yl)oxy]butanoate.
| Compound Name | ethyl 4-[(10-methoxy-2,2,4-trimethyl-1-prop-2-enyl-5H-chromeno[3,4-f]quinolin-9-yl)oxy]butanoate |
|---|---|
| PubChem CID | 90685528 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | ethyl 4-[(10-methoxy-2,2,4-trimethyl-1-prop-2-enyl-5H-chromeno[3,4-f]quinolin-9-yl)oxy]butanoate |
| SMILES | C=CCN1c2ccc3c(c2C(C)=CC1(C)C)COc1ccc(OCCCC(=O)OCC)c(OC)c1-3 |
| InChI | InChI=1S/C29H35NO5/c1-7-15-30-22-12-11-20-21(26(22)19(3)17-29(30,4)5)18-35-23-13-14-24(28(32-6)27(20)23)34-16-9-10-25(31)33-8-2/h7,11-14,17H,1,8-10,15-16,18H2,2-6H3 |
| InChIKey | QGPOHDDSRNIYJZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|