C28H32N2O5 — CID 90805615
(10-methoxy-2,2,4-trimethyl-1-prop-2-enyl-5H-chromeno[3,4-f]quinolin-9-yl) 3-acetamidopropanoate (PubChem CID 90805615) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is (10-methoxy-2,2,4-trimethyl-1-prop-2-enyl-5H-chromeno[3,4-f]quinolin-9-yl) 3-acetamidopropanoate.
| Compound Name | (10-methoxy-2,2,4-trimethyl-1-prop-2-enyl-5H-chromeno[3,4-f]quinolin-9-yl) 3-acetamidopropanoate |
|---|---|
| PubChem CID | 90805615 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (10-methoxy-2,2,4-trimethyl-1-prop-2-enyl-5H-chromeno[3,4-f]quinolin-9-yl) 3-acetamidopropanoate |
| SMILES | C=CCN1c2ccc3c(c2C(C)=CC1(C)C)COc1ccc(OC(=O)CCNC(C)=O)c(OC)c1-3 |
| InChI | InChI=1S/C28H32N2O5/c1-7-14-30-21-9-8-19-20(25(21)17(2)15-28(30,4)5)16-34-22-10-11-23(27(33-6)26(19)22)35-24(32)12-13-29-18(3)31/h7-11,15H,1,12-14,16H2,2-6H3,(H,29,31) |
| InChIKey | IQFFESQQOPJPFR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|