C23H29NO6 — CID 102376154
N-[2-(3,4,7,8,10-pentamethoxy-9,10-dihydrophenanthren-1-yl)ethyl]acetamide (PubChem CID 102376154) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[2-(3,4,7,8,10-pentamethoxy-9,10-dihydrophenanthren-1-yl)ethyl]acetamide.
| Compound Name | N-[2-(3,4,7,8,10-pentamethoxy-9,10-dihydrophenanthren-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 102376154 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[2-(3,4,7,8,10-pentamethoxy-9,10-dihydrophenanthren-1-yl)ethyl]acetamide |
| SMILES | COc1ccc2c(c1OC)CC(OC)c1c(CCNC(C)=O)cc(OC)c(OC)c1-2 |
| InChI | InChI=1S/C23H29NO6/c1-13(25)24-10-9-14-11-19(28-4)23(30-6)21-15-7-8-17(26-2)22(29-5)16(15)12-18(27-3)20(14)21/h7-8,11,18H,9-10,12H2,1-6H3,(H,24,25) |
| InChIKey | JPYMDNVLJHNGKG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |