C12H15NO4S3 — CID 11724398
N-[2-(4,5-dimethoxy-1-oxo-1λ4,2,3-benzotrithiol-7-yl)ethyl]acetamide (PubChem CID 11724398) has the molecular formula C12H15NO4S3 and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[2-(4,5-dimethoxy-1-oxo-1λ4,2,3-benzotrithiol-7-yl)ethyl]acetamide.
| Compound Name | N-[2-(4,5-dimethoxy-1-oxo-1λ4,2,3-benzotrithiol-7-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 11724398 |
| Molecular Formula | C12H15NO4S3 |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | N-[2-(4,5-dimethoxy-1-oxo-1λ4,2,3-benzotrithiol-7-yl)ethyl]acetamide |
| SMILES | COc1cc(CCNC(C)=O)c2c(c1OC)SSS2=O |
| InChI | InChI=1S/C12H15NO4S3/c1-7(14)13-5-4-8-6-9(16-2)10(17-3)11-12(8)20(15)19-18-11/h6H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | ANNCBKZGYGXSEH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|