C28H33NO4 — CID 68946453
5-cyclohex-3-en-1-yl-1,9,10-trimethoxy-2,2,4-trimethyl-5H-chromeno[3,4-f]quinoline (PubChem CID 68946453) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is 5-cyclohex-3-en-1-yl-1,9,10-trimethoxy-2,2,4-trimethyl-5H-chromeno[3,4-f]quinoline.
| Compound Name | 5-cyclohex-3-en-1-yl-1,9,10-trimethoxy-2,2,4-trimethyl-5H-chromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 68946453 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 5-cyclohex-3-en-1-yl-1,9,10-trimethoxy-2,2,4-trimethyl-5H-chromeno[3,4-f]quinoline |
| SMILES | COc1ccc2c(c1OC)-c1ccc3c(c1C(C1CC=CCC1)O2)C(C)=CC(C)(C)N3OC |
| InChI | InChI=1S/C28H33NO4/c1-17-16-28(2,3)29(32-6)20-13-12-19-24-21(14-15-22(30-4)27(24)31-5)33-26(25(19)23(17)20)18-10-8-7-9-11-18/h7-8,12-16,18,26H,9-11H2,1-6H3 |
| InChIKey | IDXVLFCQVCIMOL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|