C24H39NO3Si — CID 90327239
ethyl 4-[7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2,2,4-trimethylquinolin-1-yl]butanoate (PubChem CID 90327239) has the molecular formula C24H39NO3Si and a molecular weight of 417.67 g/mol. Its IUPAC name is ethyl 4-[7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2,2,4-trimethylquinolin-1-yl]butanoate.
| Compound Name | ethyl 4-[7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2,2,4-trimethylquinolin-1-yl]butanoate |
|---|---|
| PubChem CID | 90327239 |
| Molecular Formula | C24H39NO3Si |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | ethyl 4-[7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2,2,4-trimethylquinolin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1c2cc(CC(C)(C)[Si](C)(C)O)ccc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H39NO3Si/c1-9-28-22(26)11-10-14-25-21-15-19(17-24(5,6)29(7,8)27)12-13-20(21)18(2)16-23(25,3)4/h12-13,15-16,27H,9-11,14,17H2,1-8H3 |
| InChIKey | AGALELPCCTUABO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|