C16H23NO4S — CID 58049203
(1-butyl-7-hydroxy-2,2-dimethylquinolin-4-yl)methanesulfonic acid (PubChem CID 58049203) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is (1-butyl-7-hydroxy-2,2-dimethylquinolin-4-yl)methanesulfonic acid.
| Compound Name | (1-butyl-7-hydroxy-2,2-dimethylquinolin-4-yl)methanesulfonic acid |
|---|---|
| PubChem CID | 58049203 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (1-butyl-7-hydroxy-2,2-dimethylquinolin-4-yl)methanesulfonic acid |
| SMILES | CCCCN1c2cc(O)ccc2C(CS(=O)(=O)O)=CC1(C)C |
| InChI | InChI=1S/C16H23NO4S/c1-4-5-8-17-15-9-13(18)6-7-14(15)12(10-16(17,2)3)11-22(19,20)21/h6-7,9-10,18H,4-5,8,11H2,1-3H3,(H,19,20,21) |
| InChIKey | DMUFTQVREWMRFO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|