C32H41N2O6S2+ — CID 88555180
[6,20-diethyl-2,2,7,7,19,19-hexamethyl-17-(sulfomethyl)-6-aza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),8,11,13,15,17,20-nonaen-9-yl]methanesulfonic acid (PubChem CID 88555180) has the molecular formula C32H41N2O6S2+ and a molecular weight of 613.82 g/mol. Its IUPAC name is [6,20-diethyl-2,2,7,7,19,19-hexamethyl-17-(sulfomethyl)-6-aza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),8,11,13,15,17,20-nonaen-9-yl]methanesulfonic acid.
| Compound Name | [6,20-diethyl-2,2,7,7,19,19-hexamethyl-17-(sulfomethyl)-6-aza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),8,11,13,15,17,20-nonaen-9-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 88555180 |
| Molecular Formula | C32H41N2O6S2+ |
| Molecular Weight | 613.82 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | [6,20-diethyl-2,2,7,7,19,19-hexamethyl-17-(sulfomethyl)-6-aza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),8,11,13,15,17,20-nonaen-9-yl]methanesulfonic acid |
| SMILES | CCN1c2cc3c(cc2C(CS(=O)(=O)O)=CC1(C)C)C=c1cc2c(cc1C3(C)C)=[N+](CC)C(C)(C)C=C2CS(=O)(=O)O |
| InChI | InChI=1S/C32H40N2O6S2/c1-9-33-28-14-26-20(12-24(28)22(16-30(33,3)4)18-41(35,36)37)11-21-13-25-23(19-42(38,39)40)17-31(5,6)34(10-2)29(25)15-27(21)32(26,7)8/h11-17H,9-10,18-19H2,1-8H3,(H-,35,36,37,38,39,40)/p+1 |
| InChIKey | LVRZAWCLYISKQQ-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|